About 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene
2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene (PubChem CID 71561953) has the molecular formula C21H26O2S
and a molecular weight of 342.50 g/mol. Its IUPAC name is 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene |
| PubChem CID | 71561953 |
| Molecular Formula | C21H26O2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2ccc(C3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H26O2S/c1-15-13-16(2)21(17(3)14-15)24(22,23)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h9-14,18H,4-8H2,1-3H3 |
| InChIKey | AZAXUYOBTYALBU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene?
The IUPAC name of 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene (CID 71561953) is 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene?
The canonical SMILES for 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene is Cc1cc(C)c(S(=O)(=O)c2ccc(C3CCCCC3)cc2)c(C)c1.
What is the InChIKey of 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene?
The InChIKey is AZAXUYOBTYALBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O2S/c1-15-13-16(2)21(17(3)14-15)24(22,23)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h9-14,18H,4-8H2,1-3H3.
What are the key properties of 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene?
2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene has a molecular weight of 342.50 g/mol, XLogP of 5.49, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclohexylphenyl)sulfonyl-1,3,5-trimethylbenzene is sourced from PubChem (CID 71561953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).