C16H16N2O2S — CID 71562311
1-(2,4,6-trimethylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 71562311) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
| Compound Name | 1-(2,4,6-trimethylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 71562311 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2ccc3cccnc32)c(C)c1 |
| InChI | InChI=1S/C16H16N2O2S/c1-11-9-12(2)15(13(3)10-11)21(19,20)18-8-6-14-5-4-7-17-16(14)18/h4-10H,1-3H3 |
| InChIKey | GOOBMCRVSGDYEA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |