C17H19BN2O5 — CID 71562534
3-[(2R)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-2-boronoethyl]benzoic acid (PubChem CID 71562534) has the molecular formula C17H19BN2O5 and a molecular weight of 342.16 g/mol. Its IUPAC name is 3-[(2R)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-2-boronoethyl]benzoic acid.
| Compound Name | 3-[(2R)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-2-boronoethyl]benzoic acid |
|---|---|
| PubChem CID | 71562534 |
| Molecular Formula | C17H19BN2O5 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-[(2R)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-2-boronoethyl]benzoic acid |
| SMILES | N[C@@H](C(=O)N[C@@H](Cc1cccc(C(=O)O)c1)B(O)O)c1ccccc1 |
| InChI | InChI=1S/C17H19BN2O5/c19-15(12-6-2-1-3-7-12)16(21)20-14(18(24)25)10-11-5-4-8-13(9-11)17(22)23/h1-9,14-15,24-25H,10,19H2,(H,20,21)(H,22,23)/t14-,15+/m0/s1 |
| InChIKey | WMZXFYUXEUIIHA-LSDHHAIUSA-N |
| XLogP | 0.12 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|