C24H27BN4O9 — CID 71562535
3-[(2R)-2-borono-2-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]ethyl]benzoic acid (PubChem CID 71562535) has the molecular formula C24H27BN4O9 and a molecular weight of 526.31 g/mol. Its IUPAC name is 3-[(2R)-2-borono-2-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]ethyl]benzoic acid.
| Compound Name | 3-[(2R)-2-borono-2-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 71562535 |
| Molecular Formula | C24H27BN4O9 |
| Molecular Weight | 526.31 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 3-[(2R)-2-borono-2-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]ethyl]benzoic acid |
| SMILES | CCN1CCN(C(=O)N[C@@H](C(=O)N[C@@H](Cc2cccc(C(=O)O)c2)B(O)O)c2ccc(O)cc2)C(=O)C1=O |
| InChI | InChI=1S/C24H27BN4O9/c1-2-28-10-11-29(22(33)21(28)32)24(36)27-19(15-6-8-17(30)9-7-15)20(31)26-18(25(37)38)13-14-4-3-5-16(12-14)23(34)35/h3-9,12,18-19,30,37-38H,2,10-11,13H2,1H3,(H,26,31)(H,27,36)(H,34,35)/t18-,19+/m0/s1 |
| InChIKey | RQUAUGVUHVOHLK-RBUKOAKNSA-N |
| XLogP | -0.73 |
| TPSA | 196.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|