C18H24N4O2 — CID 71562539
N-cyclohexyl-1,3-dimethyl-4-oxo-7-prop-2-enylpyrazolo[5,4-b]pyridine-5-carboxamide (PubChem CID 71562539) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-cyclohexyl-1,3-dimethyl-4-oxo-7-prop-2-enylpyrazolo[5,4-b]pyridine-5-carboxamide.
| Compound Name | N-cyclohexyl-1,3-dimethyl-4-oxo-7-prop-2-enylpyrazolo[5,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 71562539 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-cyclohexyl-1,3-dimethyl-4-oxo-7-prop-2-enylpyrazolo[5,4-b]pyridine-5-carboxamide |
| SMILES | C=CCn1cc(C(=O)NC2CCCCC2)c(=O)c2c(C)nn(C)c21 |
| InChI | InChI=1S/C18H24N4O2/c1-4-10-22-11-14(17(24)19-13-8-6-5-7-9-13)16(23)15-12(2)20-21(3)18(15)22/h4,11,13H,1,5-10H2,2-3H3,(H,19,24) |
| InChIKey | XDQKZKVOUNRTNF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|