About (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine
(3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine (PubChem CID 71562719) has the molecular formula C17H15Cl2F2NO
and a molecular weight of 358.22 g/mol. Its IUPAC name is (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine.
Molecular Properties
| Compound Name | (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine |
| PubChem CID | 71562719 |
| Molecular Formula | C17H15Cl2F2NO |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine |
| SMILES | Fc1cc(F)c(Cl)c(O[C@H](c2ccccc2)[C@@H]2CCNC2)c1Cl |
| InChI | InChI=1S/C17H15Cl2F2NO/c18-14-12(20)8-13(21)15(19)17(14)23-16(11-6-7-22-9-11)10-4-2-1-3-5-10/h1-5,8,11,16,22H,6-7,9H2/t11-,16-/m1/s1 |
| InChIKey | IJNSXDVGJQEXPC-BDJLRTHQSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine?
The IUPAC name of (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine (CID 71562719) is (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine.
What is the SMILES notation for (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine?
The canonical SMILES for (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine is Fc1cc(F)c(Cl)c(O[C@H](c2ccccc2)[C@@H]2CCNC2)c1Cl.
What is the InChIKey of (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine?
The InChIKey is IJNSXDVGJQEXPC-BDJLRTHQSA-N. The full InChI is InChI=1S/C17H15Cl2F2NO/c18-14-12(20)8-13(21)15(19)17(14)23-16(11-6-7-22-9-11)10-4-2-1-3-5-10/h1-5,8,11,16,22H,6-7,9H2/t11-,16-/m1/s1.
What are the key properties of (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine?
(3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine has a molecular weight of 358.22 g/mol, XLogP of 5.00, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(S)-(2,6-dichloro-3,5-difluorophenoxy)-phenylmethyl]pyrrolidine is sourced from PubChem (CID 71562719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).