About 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine
2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine (PubChem CID 71562817) has the molecular formula C14H17NS3
and a molecular weight of 295.50 g/mol. Its IUPAC name is 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine.
Molecular Properties
| Compound Name | 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine |
| PubChem CID | 71562817 |
| Molecular Formula | C14H17NS3 |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine |
| SMILES | c1ccc2c(c1)CSC(SSC1CCCCC1)=N2 |
| InChI | InChI=1S/C14H17NS3/c1-2-7-12(8-3-1)17-18-14-15-13-9-5-4-6-11(13)10-16-14/h4-6,9,12H,1-3,7-8,10H2 |
| InChIKey | DEJQBSOCLDZCDX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine?
The IUPAC name of 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine (CID 71562817) is 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine.
What is the SMILES notation for 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine?
The canonical SMILES for 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine is c1ccc2c(c1)CSC(SSC1CCCCC1)=N2.
What is the InChIKey of 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine?
The InChIKey is DEJQBSOCLDZCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NS3/c1-2-7-12(8-3-1)17-18-14-15-13-9-5-4-6-11(13)10-16-14/h4-6,9,12H,1-3,7-8,10H2.
What are the key properties of 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine?
2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine has a molecular weight of 295.50 g/mol, XLogP of 5.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexyldisulfanyl)-4H-3,1-benzothiazine is sourced from PubChem (CID 71562817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).