About (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine
(3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine (PubChem CID 71562833) has the molecular formula C17H16ClF2NO
and a molecular weight of 323.77 g/mol. Its IUPAC name is (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine.
Molecular Properties
| Compound Name | (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine |
| PubChem CID | 71562833 |
| Molecular Formula | C17H16ClF2NO |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine |
| SMILES | Fc1ccc(F)c(O[C@@H](c2ccccc2)[C@H]2CCNC2)c1Cl |
| InChI | InChI=1S/C17H16ClF2NO/c18-15-13(19)6-7-14(20)17(15)22-16(12-8-9-21-10-12)11-4-2-1-3-5-11/h1-7,12,16,21H,8-10H2/t12-,16-/m0/s1 |
| InChIKey | DPINDTNFGDXWLU-LRDDRELGSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine?
The IUPAC name of (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine (CID 71562833) is (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine.
What is the SMILES notation for (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine?
The canonical SMILES for (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine is Fc1ccc(F)c(O[C@@H](c2ccccc2)[C@H]2CCNC2)c1Cl.
What is the InChIKey of (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine?
The InChIKey is DPINDTNFGDXWLU-LRDDRELGSA-N. The full InChI is InChI=1S/C17H16ClF2NO/c18-15-13(19)6-7-14(20)17(15)22-16(12-8-9-21-10-12)11-4-2-1-3-5-11/h1-7,12,16,21H,8-10H2/t12-,16-/m0/s1.
What are the key properties of (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine?
(3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine has a molecular weight of 323.77 g/mol, XLogP of 4.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(R)-(2-chloro-3,6-difluorophenoxy)-phenylmethyl]pyrrolidine is sourced from PubChem (CID 71562833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).