C17H15F4NO — CID 71562836
(3S)-3-[(R)-phenyl-(2,3,5,6-tetrafluorophenoxy)methyl]pyrrolidine (PubChem CID 71562836) has the molecular formula C17H15F4NO and a molecular weight of 325.31 g/mol. Its IUPAC name is (3S)-3-[(R)-phenyl-(2,3,5,6-tetrafluorophenoxy)methyl]pyrrolidine.
| Compound Name | (3S)-3-[(R)-phenyl-(2,3,5,6-tetrafluorophenoxy)methyl]pyrrolidine |
|---|---|
| PubChem CID | 71562836 |
| Molecular Formula | C17H15F4NO |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (3S)-3-[(R)-phenyl-(2,3,5,6-tetrafluorophenoxy)methyl]pyrrolidine |
| SMILES | Fc1cc(F)c(F)c(O[C@@H](c2ccccc2)[C@H]2CCNC2)c1F |
| InChI | InChI=1S/C17H15F4NO/c18-12-8-13(19)15(21)17(14(12)20)23-16(11-6-7-22-9-11)10-4-2-1-3-5-10/h1-5,8,11,16,22H,6-7,9H2/t11-,16-/m0/s1 |
| InChIKey | QLILSXLCYHMHMR-ZBEGNZNMSA-N |
| XLogP | 3.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|