C19H20ClN9OS — CID 71562971
7-[[4-[(3R)-3-aminopyrrolidin-1-yl]-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-1-oxido-1,2,4-benzotriazin-1-ium-3-amine (PubChem CID 71562971) has the molecular formula C19H20ClN9OS and a molecular weight of 457.95 g/mol. Its IUPAC name is 7-[[4-[(3R)-3-aminopyrrolidin-1-yl]-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-1-oxido-1,2,4-benzotriazin-1-ium-3-amine.
| Compound Name | 7-[[4-[(3R)-3-aminopyrrolidin-1-yl]-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
|---|---|
| PubChem CID | 71562971 |
| Molecular Formula | C19H20ClN9OS |
| Molecular Weight | 457.95 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 7-[[4-[(3R)-3-aminopyrrolidin-1-yl]-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
| SMILES | CCc1[nH]c2nc(Sc3ccc4nc(N)n[n+]([O-])c4c3)nc(N3CC[C@@H](N)C3)c2c1Cl |
| InChI | InChI=1S/C19H20ClN9OS/c1-2-11-15(20)14-16(23-11)25-19(26-17(14)28-6-5-9(21)8-28)31-10-3-4-12-13(7-10)29(30)27-18(22)24-12/h3-4,7,9H,2,5-6,8,21H2,1H3,(H2,22,24,27)(H,23,25,26)/t9-/m1/s1 |
| InChIKey | VAIVFGBUHRDSAV-SECBINFHSA-N |
| XLogP | 2.02 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.95 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|