C12H16ClN5O — CID 71563618
5-(chloromethyl)-2-(4-methylpiperidin-1-yl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 71563618) has the molecular formula C12H16ClN5O and a molecular weight of 281.75 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(4-methylpiperidin-1-yl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(chloromethyl)-2-(4-methylpiperidin-1-yl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 71563618 |
| Molecular Formula | C12H16ClN5O |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-(chloromethyl)-2-(4-methylpiperidin-1-yl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CC1CCN(c2nc3nc(CCl)cc(=O)n3[nH]2)CC1 |
| InChI | InChI=1S/C12H16ClN5O/c1-8-2-4-17(5-3-8)12-15-11-14-9(7-13)6-10(19)18(11)16-12/h6,8H,2-5,7H2,1H3,(H,14,15,16) |
| InChIKey | OLJJIHAJDZOMJG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|