About 3-(iodomethyl)-1,1-dimethylcyclobutane
3-(iodomethyl)-1,1-dimethylcyclobutane (PubChem CID 71565348) has the molecular formula C7H13I
and a molecular weight of 224.08 g/mol. Its IUPAC name is 3-(iodomethyl)-1,1-dimethylcyclobutane.
Molecular Properties
| Compound Name | 3-(iodomethyl)-1,1-dimethylcyclobutane |
| PubChem CID | 71565348 |
| Molecular Formula | C7H13I |
| Molecular Weight | 224.08 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 3-(iodomethyl)-1,1-dimethylcyclobutane |
| SMILES | CC1(C)CC(CI)C1 |
| InChI | InChI=1S/C7H13I/c1-7(2)3-6(4-7)5-8/h6H,3-5H2,1-2H3 |
| InChIKey | BOOVMEMADPXHFY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.08 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(iodomethyl)-1,1-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(iodomethyl)-1,1-dimethylcyclobutane?
The IUPAC name of 3-(iodomethyl)-1,1-dimethylcyclobutane (CID 71565348) is 3-(iodomethyl)-1,1-dimethylcyclobutane.
What is the SMILES notation for 3-(iodomethyl)-1,1-dimethylcyclobutane?
The canonical SMILES for 3-(iodomethyl)-1,1-dimethylcyclobutane is CC1(C)CC(CI)C1.
What is the InChIKey of 3-(iodomethyl)-1,1-dimethylcyclobutane?
The InChIKey is BOOVMEMADPXHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13I/c1-7(2)3-6(4-7)5-8/h6H,3-5H2,1-2H3.
What are the key properties of 3-(iodomethyl)-1,1-dimethylcyclobutane?
3-(iodomethyl)-1,1-dimethylcyclobutane has a molecular weight of 224.08 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(iodomethyl)-1,1-dimethylcyclobutane is sourced from PubChem (CID 71565348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).