C18H21N3O4 — CID 71565363
tert-butyl (2S)-2-[(3-nitro-2-pyridinyl)amino]-3-phenylpropanoate (PubChem CID 71565363) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3-nitro-2-pyridinyl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[(3-nitro-2-pyridinyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 71565363 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | tert-butyl (2S)-2-[(3-nitro-2-pyridinyl)amino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)Nc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N3O4/c1-18(2,3)25-17(22)14(12-13-8-5-4-6-9-13)20-16-15(21(23)24)10-7-11-19-16/h4-11,14H,12H2,1-3H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | LDXHPKHCJOHVNH-AWEZNQCLSA-N |
| XLogP | 3.35 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|