About tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate
tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate (PubChem CID 71565374) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate |
| PubChem CID | 71565374 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate |
| SMILES | C[C@@H](C(=O)OC(C)(C)C)n1c(=O)c(=O)[nH]c2cccnc21 |
| InChI | InChI=1S/C14H17N3O4/c1-8(13(20)21-14(2,3)4)17-10-9(6-5-7-15-10)16-11(18)12(17)19/h5-8H,1-4H3,(H,16,18)/t8-/m0/s1 |
| InChIKey | VFKNYTPNUHASNS-QMMMGPOBSA-N |
| XLogP | 0.99 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate?
The IUPAC name of tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate (CID 71565374) is tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate.
What is the SMILES notation for tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate?
The canonical SMILES for tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate is C[C@@H](C(=O)OC(C)(C)C)n1c(=O)c(=O)[nH]c2cccnc21.
What is the InChIKey of tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate?
The InChIKey is VFKNYTPNUHASNS-QMMMGPOBSA-N. The full InChI is InChI=1S/C14H17N3O4/c1-8(13(20)21-14(2,3)4)17-10-9(6-5-7-15-10)16-11(18)12(17)19/h5-8H,1-4H3,(H,16,18)/t8-/m0/s1.
What are the key properties of tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate?
tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate has a molecular weight of 291.31 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(2,3-dioxo-1H-pyrido[2,3-b]pyrazin-4-yl)propanoate is sourced from PubChem (CID 71565374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).