C28H21F2NO5S — CID 71565772
(2S)-1-[3-[[4-(4,5-difluoro-2-formyl-1-benzothiophen-7-yl)phenoxy]methyl]benzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 71565772) has the molecular formula C28H21F2NO5S and a molecular weight of 521.54 g/mol. Its IUPAC name is (2S)-1-[3-[[4-(4,5-difluoro-2-formyl-1-benzothiophen-7-yl)phenoxy]methyl]benzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-[[4-(4,5-difluoro-2-formyl-1-benzothiophen-7-yl)phenoxy]methyl]benzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 71565772 |
| Molecular Formula | C28H21F2NO5S |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | (2S)-1-[3-[[4-(4,5-difluoro-2-formyl-1-benzothiophen-7-yl)phenoxy]methyl]benzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=Cc1cc2c(F)c(F)cc(-c3ccc(OCc4cccc(C(=O)N5CCC[C@H]5C(=O)O)c4)cc3)c2s1 |
| InChI | InChI=1S/C28H21F2NO5S/c29-23-13-21(26-22(25(23)30)12-20(14-32)37-26)17-6-8-19(9-7-17)36-15-16-3-1-4-18(11-16)27(33)31-10-2-5-24(31)28(34)35/h1,3-4,6-9,11-14,24H,2,5,10,15H2,(H,34,35)/t24-/m0/s1 |
| InChIKey | WDXNVZXANWRTPW-DEOSSOPVSA-N |
| XLogP | 5.93 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|