C29H33FN3O2+ — CID 71566319
[2-[4-(4-fluorophenoxy)phenyl]-6-methyl-4-pyridinyl]-[4-(1-methylpyrrolidin-1-ium-1-yl)piperidin-1-yl]methanone (PubChem CID 71566319) has the molecular formula C29H33FN3O2+ and a molecular weight of 474.60 g/mol. Its IUPAC name is [2-[4-(4-fluorophenoxy)phenyl]-6-methyl-4-pyridinyl]-[4-(1-methylpyrrolidin-1-ium-1-yl)piperidin-1-yl]methanone.
| Compound Name | [2-[4-(4-fluorophenoxy)phenyl]-6-methyl-4-pyridinyl]-[4-(1-methylpyrrolidin-1-ium-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 71566319 |
| Molecular Formula | C29H33FN3O2+ |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | [2-[4-(4-fluorophenoxy)phenyl]-6-methyl-4-pyridinyl]-[4-(1-methylpyrrolidin-1-ium-1-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC([N+]3(C)CCCC3)CC2)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C29H33FN3O2/c1-21-19-23(29(34)32-15-13-25(14-16-32)33(2)17-3-4-18-33)20-28(31-21)22-5-9-26(10-6-22)35-27-11-7-24(30)8-12-27/h5-12,19-20,25H,3-4,13-18H2,1-2H3/q+1 |
| InChIKey | CGOSPBRFEXUIFP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|