C27H32FN3O5S — CID 71566575
N-(1,1-dimethylpiperidin-1-ium-4-yl)-6-[4-(4-fluorophenoxy)phenyl]-N-methylpyridine-2-carboxamide;methanesulfonate (PubChem CID 71566575) has the molecular formula C27H32FN3O5S and a molecular weight of 529.63 g/mol. Its IUPAC name is N-(1,1-dimethylpiperidin-1-ium-4-yl)-6-[4-(4-fluorophenoxy)phenyl]-N-methylpyridine-2-carboxamide;methanesulfonate.
| Compound Name | N-(1,1-dimethylpiperidin-1-ium-4-yl)-6-[4-(4-fluorophenoxy)phenyl]-N-methylpyridine-2-carboxamide;methanesulfonate |
|---|---|
| PubChem CID | 71566575 |
| Molecular Formula | C27H32FN3O5S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | N-(1,1-dimethylpiperidin-1-ium-4-yl)-6-[4-(4-fluorophenoxy)phenyl]-N-methylpyridine-2-carboxamide;methanesulfonate |
| SMILES | CN(C(=O)c1cccc(-c2ccc(Oc3ccc(F)cc3)cc2)n1)C1CC[N+](C)(C)CC1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C26H29FN3O2.CH4O3S/c1-29(21-15-17-30(2,3)18-16-21)26(31)25-6-4-5-24(28-25)19-7-11-22(12-8-19)32-23-13-9-20(27)10-14-23;1-5(2,3)4/h4-14,21H,15-18H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | NDXGLQVSHWXGDB-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|