C22H30N6O5 — CID 71566652
(2S)-2-[[2-[(1S,2S)-1-benzamido-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 71566652) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is (2S)-2-[[2-[(1S,2S)-1-benzamido-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[2-[(1S,2S)-1-benzamido-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 71566652 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (2S)-2-[[2-[(1S,2S)-1-benzamido-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccccc1)c1nc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)co1 |
| InChI | InChI=1S/C22H30N6O5/c1-3-13(2)17(28-18(29)14-8-5-4-6-9-14)20-27-16(12-33-20)19(30)26-15(21(31)32)10-7-11-25-22(23)24/h4-6,8-9,12-13,15,17H,3,7,10-11H2,1-2H3,(H,26,30)(H,28,29)(H,31,32)(H4,23,24,25)/t13-,15-,17-/m0/s1 |
| InChIKey | SQROLYHEFVJVLY-QRTARXTBSA-N |
| XLogP | 1.43 |
| TPSA | 185.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|