C29H36N6O5 — CID 71566653
(2S)-5-(diaminomethylideneamino)-2-[[2-[(1S,2S)-1-[(2,2-diphenylacetyl)amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid (PubChem CID 71566653) has the molecular formula C29H36N6O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S,2S)-1-[(2,2-diphenylacetyl)amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S,2S)-1-[(2,2-diphenylacetyl)amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 71566653 |
| Molecular Formula | C29H36N6O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S,2S)-1-[(2,2-diphenylacetyl)amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)C(c1ccccc1)c1ccccc1)c1nc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)co1 |
| InChI | InChI=1S/C29H36N6O5/c1-3-18(2)24(35-26(37)23(19-11-6-4-7-12-19)20-13-8-5-9-14-20)27-34-22(17-40-27)25(36)33-21(28(38)39)15-10-16-32-29(30)31/h4-9,11-14,17-18,21,23-24H,3,10,15-16H2,1-2H3,(H,33,36)(H,35,37)(H,38,39)(H4,30,31,32)/t18-,21-,24-/m0/s1 |
| InChIKey | SYEFMYZIOKNUOV-XZOYJPPVSA-N |
| XLogP | 2.95 |
| TPSA | 185.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|