C23H43N7O4 — CID 71566713
N-[(3S,6S,9R)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4,7-triazacyclopentadec-9-yl]-2-methylpropanamide (PubChem CID 71566713) has the molecular formula C23H43N7O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is N-[(3S,6S,9R)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4,7-triazacyclopentadec-9-yl]-2-methylpropanamide.
| Compound Name | N-[(3S,6S,9R)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4,7-triazacyclopentadec-9-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 71566713 |
| Molecular Formula | C23H43N7O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | N-[(3S,6S,9R)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4,7-triazacyclopentadec-9-yl]-2-methylpropanamide |
| SMILES | CC[C@@H]1NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@](C)(NC(=O)C(C)C)CCCCCCNC1=O |
| InChI | InChI=1S/C23H43N7O4/c1-5-16-19(32)26-13-9-7-6-8-12-23(4,30-18(31)15(2)3)21(34)29-17(20(33)28-16)11-10-14-27-22(24)25/h15-17H,5-14H2,1-4H3,(H,26,32)(H,28,33)(H,29,34)(H,30,31)(H4,24,25,27)/t16-,17-,23+/m0/s1 |
| InChIKey | MPVOXWRVJVMKGM-HKARXFIJSA-N |
| XLogP | 0.03 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|