C32H22BF2N3 — CID 71567029
2,2-difluoro-4,6,10,12-tetraphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71567029) has the molecular formula C32H22BF2N3 and a molecular weight of 497.36 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetraphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetraphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71567029 |
| Molecular Formula | C32H22BF2N3 |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetraphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | F[B-]1(F)n2c(-c3ccccc3)cc(-c3ccccc3)c2N=C2C(c3ccccc3)=CC(c3ccccc3)=[N+]21 |
| InChI | InChI=1S/C32H22BF2N3/c34-33(35)37-29(25-17-9-3-10-18-25)21-27(23-13-5-1-6-14-23)31(37)36-32-28(24-15-7-2-8-16-24)22-30(38(32)33)26-19-11-4-12-20-26/h1-22H |
| InChIKey | ZRHFBKZCOBJRTC-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|