C27H43NO4Si — CID 71567164
(4S)-4-benzyl-3-[(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-methylidenenonanoyl]-1,3-oxazolidin-2-one (PubChem CID 71567164) has the molecular formula C27H43NO4Si and a molecular weight of 473.73 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-methylidenenonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-methylidenenonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71567164 |
| Molecular Formula | C27H43NO4Si |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | (4S)-4-benzyl-3-[(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-methylidenenonanoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(C[C@@H](CCC)O[Si](C)(C)C(C)(C)C)C[C@@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H43NO4Si/c1-9-13-24(32-33(7,8)27(4,5)6)17-20(2)16-21(3)25(29)28-23(19-31-26(28)30)18-22-14-11-10-12-15-22/h10-12,14-15,21,23-24H,2,9,13,16-19H2,1,3-8H3/t21-,23+,24-/m1/s1 |
| InChIKey | LBANLSLYDXEMFX-YFNKSVMNSA-N |
| XLogP | 6.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|