About 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide
4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide (PubChem CID 71568157) has the molecular formula C14H12BNO4
and a molecular weight of 269.07 g/mol. Its IUPAC name is 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide.
Molecular Properties
| Compound Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide |
| PubChem CID | 71568157 |
| Molecular Formula | C14H12BNO4 |
| Molecular Weight | 269.07 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C14H12BNO4/c16-14(17)9-1-4-11(5-2-9)20-12-6-3-10-8-19-15(18)13(10)7-12/h1-7,18H,8H2,(H2,16,17) |
| InChIKey | DSFLJEGHWQILOG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.07 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide?
The IUPAC name of 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide (CID 71568157) is 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide.
What is the SMILES notation for 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide?
The canonical SMILES for 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide is NC(=O)c1ccc(Oc2ccc3c(c2)B(O)OC3)cc1.
What is the InChIKey of 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide?
The InChIKey is DSFLJEGHWQILOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BNO4/c16-14(17)9-1-4-11(5-2-9)20-12-6-3-10-8-19-15(18)13(10)7-12/h1-7,18H,8H2,(H2,16,17).
What are the key properties of 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide?
4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide has a molecular weight of 269.07 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]benzamide is sourced from PubChem (CID 71568157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).