About 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea
1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 71568395) has the molecular formula C14H9F5N2OS
and a molecular weight of 348.30 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
| PubChem CID | 71568395 |
| Molecular Formula | C14H9F5N2OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(Nc1cc(F)cc(F)c1)Nc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F5N2OS/c15-8-4-9(16)6-11(5-8)21-13(22)20-10-2-1-3-12(7-10)23-14(17,18)19/h1-7H,(H2,20,21,22) |
| InChIKey | OIYRJFWWKFPITI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea?
The IUPAC name of 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea (CID 71568395) is 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea.
What is the SMILES notation for 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea?
The canonical SMILES for 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea is O=C(Nc1cc(F)cc(F)c1)Nc1cccc(SC(F)(F)F)c1.
What is the InChIKey of 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea?
The InChIKey is OIYRJFWWKFPITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F5N2OS/c15-8-4-9(16)6-11(5-8)21-13(22)20-10-2-1-3-12(7-10)23-14(17,18)19/h1-7H,(H2,20,21,22).
What are the key properties of 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea?
1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea has a molecular weight of 348.30 g/mol, XLogP of 5.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-difluorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea is sourced from PubChem (CID 71568395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).