About 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea
1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea (PubChem CID 71568397) has the molecular formula C14H8F6N2O
and a molecular weight of 334.22 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea |
| PubChem CID | 71568397 |
| Molecular Formula | C14H8F6N2O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H8F6N2O/c15-10-5-9(6-11(16)12(10)17)22-13(23)21-8-3-1-7(2-4-8)14(18,19)20/h1-6H,(H2,21,22,23) |
| InChIKey | SLPPBGYTIOUJPS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea?
The IUPAC name of 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea (CID 71568397) is 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea.
What is the SMILES notation for 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea?
The canonical SMILES for 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea is O=C(Nc1ccc(C(F)(F)F)cc1)Nc1cc(F)c(F)c(F)c1.
What is the InChIKey of 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea?
The InChIKey is SLPPBGYTIOUJPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F6N2O/c15-10-5-9(6-11(16)12(10)17)22-13(23)21-8-3-1-7(2-4-8)14(18,19)20/h1-6H,(H2,21,22,23).
What are the key properties of 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea?
1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea has a molecular weight of 334.22 g/mol, XLogP of 4.77, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)urea is sourced from PubChem (CID 71568397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).