C11H19NO — CID 71568771
(1S,5R)-1,4,4-trimethyl-9-azabicyclo[3.3.1]nonan-3-one (PubChem CID 71568771) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (1S,5R)-1,4,4-trimethyl-9-azabicyclo[3.3.1]nonan-3-one.
| Compound Name | (1S,5R)-1,4,4-trimethyl-9-azabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 71568771 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (1S,5R)-1,4,4-trimethyl-9-azabicyclo[3.3.1]nonan-3-one |
| SMILES | CC1(C)C(=O)C[C@]2(C)CCC[C@H]1N2 |
| InChI | InChI=1S/C11H19NO/c1-10(2)8-5-4-6-11(3,12-8)7-9(10)13/h8,12H,4-7H2,1-3H3/t8-,11+/m1/s1 |
| InChIKey | MTTCTOIJWUFQDH-KCJUWKMLSA-N |
| XLogP | 1.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |