C37H51NO3 — CID 71568947
4-[2-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]ethyl]phenol (PubChem CID 71568947) has the molecular formula C37H51NO3 and a molecular weight of 557.82 g/mol. Its IUPAC name is 4-[2-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]ethyl]phenol.
| Compound Name | 4-[2-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]ethyl]phenol |
|---|---|
| PubChem CID | 71568947 |
| Molecular Formula | C37H51NO3 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.39 |
| IUPAC Name | 4-[2-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]ethyl]phenol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c3c(cc(C)c2O1)OCN(CCc1ccc(O)cc1)C3 |
| InChI | InChI=1S/C37H51NO3/c1-27(2)10-7-11-28(3)12-8-13-29(4)14-9-21-37(6)22-19-33-34-25-38(23-20-31-15-17-32(39)18-16-31)26-40-35(34)24-30(5)36(33)41-37/h10,12,14-18,24,39H,7-9,11,13,19-23,25-26H2,1-6H3/b28-12+,29-14+/t37-/m1/s1 |
| InChIKey | VFISXNLCGJWOBC-AINUZZEPSA-N |
| XLogP | 9.38 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|