C39H57NO4 — CID 71569106
(2R)-5-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol (PubChem CID 71569106) has the molecular formula C39H57NO4 and a molecular weight of 603.89 g/mol. Its IUPAC name is (2R)-5-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol.
| Compound Name | (2R)-5-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 71569106 |
| Molecular Formula | C39H57NO4 |
| Molecular Weight | 603.89 g/mol |
| Exact Mass | 603.43 |
| IUPAC Name | (2R)-5-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
| SMILES | COc1ccc(CCNCc2c(O)c(C)c(C)c3c2CC[C@@](C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)O3)cc1OC |
| InChI | InChI=1S/C39H57NO4/c1-27(2)13-10-14-28(3)15-11-16-29(4)17-12-22-39(7)23-20-33-34(37(41)30(5)31(6)38(33)44-39)26-40-24-21-32-18-19-35(42-8)36(25-32)43-9/h13,15,17-19,25,40-41H,10-12,14,16,20-24,26H2,1-9H3/b28-15+,29-17+/t39-/m1/s1 |
| InChIKey | LCOUPPMJEXLIIX-XURTUQHWSA-N |
| XLogP | 9.64 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.89 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|