C35H55NO3 — CID 71569264
6-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]hexan-1-ol (PubChem CID 71569264) has the molecular formula C35H55NO3 and a molecular weight of 537.83 g/mol. Its IUPAC name is 6-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]hexan-1-ol.
| Compound Name | 6-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 71569264 |
| Molecular Formula | C35H55NO3 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | 6-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]hexan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c3c(cc(C)c2O1)OCN(CCCCCCO)C3 |
| InChI | InChI=1S/C35H55NO3/c1-27(2)14-11-15-28(3)16-12-17-29(4)18-13-20-35(6)21-19-31-32-25-36(22-9-7-8-10-23-37)26-38-33(32)24-30(5)34(31)39-35/h14,16,18,24,37H,7-13,15,17,19-23,25-26H2,1-6H3/b28-16+,29-18+/t35-/m1/s1 |
| InChIKey | GDLMZPMMZSSJMK-OYRPZATBSA-N |
| XLogP | 8.98 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|