C17H29N3 — CID 71569282
(1R,2R,3R,5R)-N-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine (PubChem CID 71569282) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is (1R,2R,3R,5R)-N-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,3R,5R)-N-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 71569282 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | (1R,2R,3R,5R)-N-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
| SMILES | CCc1nc(CN[C@@H]2C[C@H]3C[C@H]([C@H]2C)C3(C)C)c(C)[nH]1 |
| InChI | InChI=1S/C17H29N3/c1-6-16-19-11(3)15(20-16)9-18-14-8-12-7-13(10(14)2)17(12,4)5/h10,12-14,18H,6-9H2,1-5H3,(H,19,20)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | RQXKTYPWKWDMIK-FMKGYKFTSA-N |
| XLogP | 3.44 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |