C9H12N4O5 — CID 71569322
2-(9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocin-4-yl)acetic acid (PubChem CID 71569322) has the molecular formula C9H12N4O5 and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-(9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocin-4-yl)acetic acid.
| Compound Name | 2-(9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocin-4-yl)acetic acid |
|---|---|
| PubChem CID | 71569322 |
| Molecular Formula | C9H12N4O5 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocin-4-yl)acetic acid |
| SMILES | O=C(O)CN1CCOc2nc([N+](=O)[O-])cn2CC1 |
| InChI | InChI=1S/C9H12N4O5/c14-8(15)6-11-1-2-12-5-7(13(16)17)10-9(12)18-4-3-11/h5H,1-4,6H2,(H,14,15) |
| InChIKey | RHPXGNDRVKSXQQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|