About 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine
3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine (PubChem CID 71569598) has the molecular formula C22H12F7N3
and a molecular weight of 451.35 g/mol. Its IUPAC name is 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine.
Molecular Properties
| Compound Name | 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine |
| PubChem CID | 71569598 |
| Molecular Formula | C22H12F7N3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine |
| SMILES | Fc1ccc(-c2ccncc2-n2cncc2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H12F7N3/c23-17-3-1-13(2-4-17)18-5-6-30-11-20(18)32-12-31-10-19(32)14-7-15(21(24,25)26)9-16(8-14)22(27,28)29/h1-12H |
| InChIKey | RJOKBWLJZSVHKU-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine?
The IUPAC name of 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine (CID 71569598) is 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine.
What is the SMILES notation for 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine?
The canonical SMILES for 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine is Fc1ccc(-c2ccncc2-n2cncc2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine?
The InChIKey is RJOKBWLJZSVHKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12F7N3/c23-17-3-1-13(2-4-17)18-5-6-30-11-20(18)32-12-31-10-19(32)14-7-15(21(24,25)26)9-16(8-14)22(27,28)29/h1-12H.
What are the key properties of 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine?
3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine has a molecular weight of 451.35 g/mol, XLogP of 6.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]-4-(4-fluorophenyl)pyridine is sourced from PubChem (CID 71569598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).