About 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one
1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one (PubChem CID 71569884) has the molecular formula C31H30O5S2
and a molecular weight of 546.71 g/mol. Its IUPAC name is 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one.
Molecular Properties
| Compound Name | 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one |
| PubChem CID | 71569884 |
| Molecular Formula | C31H30O5S2 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one |
| SMILES | Cc1ccc(C(CC(=O)CC(c2ccc(C)cc2)S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30O5S2/c1-23-13-17-25(18-14-23)30(37(33,34)28-9-5-3-6-10-28)21-27(32)22-31(26-19-15-24(2)16-20-26)38(35,36)29-11-7-4-8-12-29/h3-20,30-31H,21-22H2,1-2H3 |
| InChIKey | ZQRZTAXLHPEWSF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one?
The IUPAC name of 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one (CID 71569884) is 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one.
What is the SMILES notation for 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one?
The canonical SMILES for 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one is Cc1ccc(C(CC(=O)CC(c2ccc(C)cc2)S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one?
The InChIKey is ZQRZTAXLHPEWSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H30O5S2/c1-23-13-17-25(18-14-23)30(37(33,34)28-9-5-3-6-10-28)21-27(32)22-31(26-19-15-24(2)16-20-26)38(35,36)29-11-7-4-8-12-29/h3-20,30-31H,21-22H2,1-2H3.
What are the key properties of 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one?
1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one has a molecular weight of 546.71 g/mol, XLogP of 6.38, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(benzenesulfonyl)-1,5-bis(4-methylphenyl)pentan-3-one is sourced from PubChem (CID 71569884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).