C23H23N5O3 — CID 71569982
4-[[3-(1-methylindol-5-yl)phenyl]methyl]-9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocine (PubChem CID 71569982) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-[[3-(1-methylindol-5-yl)phenyl]methyl]-9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocine.
| Compound Name | 4-[[3-(1-methylindol-5-yl)phenyl]methyl]-9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocine |
|---|---|
| PubChem CID | 71569982 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-[[3-(1-methylindol-5-yl)phenyl]methyl]-9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocine |
| SMILES | Cn1ccc2cc(-c3cccc(CN4CCOc5nc([N+](=O)[O-])cn5CC4)c3)ccc21 |
| InChI | InChI=1S/C23H23N5O3/c1-25-8-7-20-14-19(5-6-21(20)25)18-4-2-3-17(13-18)15-26-9-10-27-16-22(28(29)30)24-23(27)31-12-11-26/h2-8,13-14,16H,9-12,15H2,1H3 |
| InChIKey | NVNPLORHWHMQDQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|