About 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one
1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one (PubChem CID 71570035) has the molecular formula C29H26O5S2
and a molecular weight of 518.66 g/mol. Its IUPAC name is 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one.
Molecular Properties
| Compound Name | 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one |
| PubChem CID | 71570035 |
| Molecular Formula | C29H26O5S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one |
| SMILES | O=C(CC(c1ccccc1)S(=O)(=O)c1ccccc1)CC(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H26O5S2/c30-25(21-28(23-13-5-1-6-14-23)35(31,32)26-17-9-3-10-18-26)22-29(24-15-7-2-8-16-24)36(33,34)27-19-11-4-12-20-27/h1-20,28-29H,21-22H2 |
| InChIKey | WBOBTHDMUMBWLK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one?
The IUPAC name of 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one (CID 71570035) is 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one.
What is the SMILES notation for 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one?
The canonical SMILES for 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one is O=C(CC(c1ccccc1)S(=O)(=O)c1ccccc1)CC(c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one?
The InChIKey is WBOBTHDMUMBWLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26O5S2/c30-25(21-28(23-13-5-1-6-14-23)35(31,32)26-17-9-3-10-18-26)22-29(24-15-7-2-8-16-24)36(33,34)27-19-11-4-12-20-27/h1-20,28-29H,21-22H2.
What are the key properties of 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one?
1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one has a molecular weight of 518.66 g/mol, XLogP of 5.77, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(benzenesulfonyl)-1,5-diphenylpentan-3-one is sourced from PubChem (CID 71570035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).