C21H20N2O3 — CID 71570206
4-(3,4-dimethoxyphenyl)-6-phenyl-1,2,4,5-tetrahydroindazol-3-one (PubChem CID 71570206) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-6-phenyl-1,2,4,5-tetrahydroindazol-3-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-6-phenyl-1,2,4,5-tetrahydroindazol-3-one |
|---|---|
| PubChem CID | 71570206 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-6-phenyl-1,2,4,5-tetrahydroindazol-3-one |
| SMILES | COc1ccc(C2CC(c3ccccc3)=Cc3[nH][nH]c(=O)c32)cc1OC |
| InChI | InChI=1S/C21H20N2O3/c1-25-18-9-8-14(12-19(18)26-2)16-10-15(13-6-4-3-5-7-13)11-17-20(16)21(24)23-22-17/h3-9,11-12,16H,10H2,1-2H3,(H2,22,23,24) |
| InChIKey | PYHNFNNRLIMZOF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |