C23H20Cl2N4O2 — CID 71570212
9-(4-chlorophenyl)-13-(3-chloropropyl)-5-ethoxy-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaene (PubChem CID 71570212) has the molecular formula C23H20Cl2N4O2 and a molecular weight of 455.35 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-13-(3-chloropropyl)-5-ethoxy-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaene.
| Compound Name | 9-(4-chlorophenyl)-13-(3-chloropropyl)-5-ethoxy-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaene |
|---|---|
| PubChem CID | 71570212 |
| Molecular Formula | C23H20Cl2N4O2 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 9-(4-chlorophenyl)-13-(3-chloropropyl)-5-ethoxy-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaene |
| SMILES | CCOc1ccc2c(c1)Oc1ncn3nc(CCCCl)nc3c1C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2N4O2/c1-2-30-16-9-10-17-18(12-16)31-23-21(20(17)14-5-7-15(25)8-6-14)22-27-19(4-3-11-24)28-29(22)13-26-23/h5-10,12-13,20H,2-4,11H2,1H3 |
| InChIKey | YMXVXYUCCZIJCA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|