About 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide
2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide (PubChem CID 71570216) has the molecular formula C23H20N2O3
and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide |
| PubChem CID | 71570216 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide |
| SMILES | O=C(COc1cccc2c1NC(=O)CC2)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O3/c26-21-14-11-18-7-4-8-20(23(18)25-21)28-15-22(27)24-19-12-9-17(10-13-19)16-5-2-1-3-6-16/h1-10,12-13H,11,14-15H2,(H,24,27)(H,25,26) |
| InChIKey | OGCNDRDIBYNRLI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide?
The IUPAC name of 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide (CID 71570216) is 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide.
What is the SMILES notation for 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide?
The canonical SMILES for 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide is O=C(COc1cccc2c1NC(=O)CC2)Nc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide?
The InChIKey is OGCNDRDIBYNRLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O3/c26-21-14-11-18-7-4-8-20(23(18)25-21)28-15-22(27)24-19-12-9-17(10-13-19)16-5-2-1-3-6-16/h1-10,12-13H,11,14-15H2,(H,24,27)(H,25,26).
What are the key properties of 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide?
2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide has a molecular weight of 372.42 g/mol, XLogP of 4.26, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-oxo-3,4-dihydro-1H-quinolin-8-yl)oxy]-N-(4-phenylphenyl)acetamide is sourced from PubChem (CID 71570216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).