C22H22N2O4 — CID 71570356
6-phenyl-4-(3,4,5-trimethoxyphenyl)-1,2,4,5-tetrahydroindazol-3-one (PubChem CID 71570356) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 6-phenyl-4-(3,4,5-trimethoxyphenyl)-1,2,4,5-tetrahydroindazol-3-one.
| Compound Name | 6-phenyl-4-(3,4,5-trimethoxyphenyl)-1,2,4,5-tetrahydroindazol-3-one |
|---|---|
| PubChem CID | 71570356 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 6-phenyl-4-(3,4,5-trimethoxyphenyl)-1,2,4,5-tetrahydroindazol-3-one |
| SMILES | COc1cc(C2CC(c3ccccc3)=Cc3[nH][nH]c(=O)c32)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N2O4/c1-26-18-11-15(12-19(27-2)21(18)28-3)16-9-14(13-7-5-4-6-8-13)10-17-20(16)22(25)24-23-17/h4-8,10-12,16H,9H2,1-3H3,(H2,23,24,25) |
| InChIKey | DHLAVAADLFCNCZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |