About 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one
1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one (PubChem CID 71570483) has the molecular formula C19H19BrN2O
and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one |
| PubChem CID | 71570483 |
| Molecular Formula | C19H19BrN2O |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one |
| SMILES | CN1CCCC12C(=O)N(Cc1ccc(Br)cc1)c1ccccc12 |
| InChI | InChI=1S/C19H19BrN2O/c1-21-12-4-11-19(21)16-5-2-3-6-17(16)22(18(19)23)13-14-7-9-15(20)10-8-14/h2-3,5-10H,4,11-13H2,1H3 |
| InChIKey | GGZYNACHZGNEJH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one?
The IUPAC name of 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one (CID 71570483) is 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one.
What is the SMILES notation for 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one?
The canonical SMILES for 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one is CN1CCCC12C(=O)N(Cc1ccc(Br)cc1)c1ccccc12.
What is the InChIKey of 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one?
The InChIKey is GGZYNACHZGNEJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrN2O/c1-21-12-4-11-19(21)16-5-2-3-6-17(16)22(18(19)23)13-14-7-9-15(20)10-8-14/h2-3,5-10H,4,11-13H2,1H3.
What are the key properties of 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one?
1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one has a molecular weight of 371.28 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromophenyl)methyl]-1'-methylspiro[indole-3,2'-pyrrolidine]-2-one is sourced from PubChem (CID 71570483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).