About 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole]
1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole] (PubChem CID 71570486) has the molecular formula C21H20FN3O2
and a molecular weight of 365.41 g/mol. Its IUPAC name is 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole].
Molecular Properties
| Compound Name | 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole] |
| PubChem CID | 71570486 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole] |
| SMILES | Cn1cc(-c2ccc(CN3CC4(OCCO4)c4ccccc43)c(F)c2)cn1 |
| InChI | InChI=1S/C21H20FN3O2/c1-24-12-17(11-23-24)15-6-7-16(19(22)10-15)13-25-14-21(26-8-9-27-21)18-4-2-3-5-20(18)25/h2-7,10-12H,8-9,13-14H2,1H3 |
| InChIKey | WGGGPDGYZIHDGQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole]?
The IUPAC name of 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole] (CID 71570486) is 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole].
What is the SMILES notation for 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole]?
The canonical SMILES for 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole] is Cn1cc(-c2ccc(CN3CC4(OCCO4)c4ccccc43)c(F)c2)cn1.
What is the InChIKey of 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole]?
The InChIKey is WGGGPDGYZIHDGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FN3O2/c1-24-12-17(11-23-24)15-6-7-16(19(22)10-15)13-25-14-21(26-8-9-27-21)18-4-2-3-5-20(18)25/h2-7,10-12H,8-9,13-14H2,1H3.
What are the key properties of 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole]?
1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole] has a molecular weight of 365.41 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]spiro[1,3-dioxolane-2,3'-2H-indole] is sourced from PubChem (CID 71570486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).