C41H58N2O2 — CID 71570812
(8R)-2-(1-benzylpiperidin-4-yl)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine (PubChem CID 71570812) has the molecular formula C41H58N2O2 and a molecular weight of 610.93 g/mol. Its IUPAC name is (8R)-2-(1-benzylpiperidin-4-yl)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine.
| Compound Name | (8R)-2-(1-benzylpiperidin-4-yl)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine |
|---|---|
| PubChem CID | 71570812 |
| Molecular Formula | C41H58N2O2 |
| Molecular Weight | 610.93 g/mol |
| Exact Mass | 610.45 |
| IUPAC Name | (8R)-2-(1-benzylpiperidin-4-yl)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c3c(cc(C)c2O1)OCN(C1CCN(Cc2ccccc2)CC1)C3 |
| InChI | InChI=1S/C41H58N2O2/c1-31(2)13-10-14-32(3)15-11-16-33(4)17-12-23-41(6)24-20-37-38-29-43(30-44-39(38)27-34(5)40(37)45-41)36-21-25-42(26-22-36)28-35-18-8-7-9-19-35/h7-9,13,15,17-19,27,36H,10-12,14,16,20-26,28-30H2,1-6H3/b32-15+,33-17+/t41-/m1/s1 |
| InChIKey | XMGWHBFXOJMIJQ-XSTLDGTKSA-N |
| XLogP | 10.09 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.93 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|