C31H47NO3 — CID 71570815
2-[(7R)-5,7-dimethyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,4,8,9-tetrahydropyrano[2,3-g][1,3]benzoxazin-3-yl]ethanol (PubChem CID 71570815) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is 2-[(7R)-5,7-dimethyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,4,8,9-tetrahydropyrano[2,3-g][1,3]benzoxazin-3-yl]ethanol.
| Compound Name | 2-[(7R)-5,7-dimethyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,4,8,9-tetrahydropyrano[2,3-g][1,3]benzoxazin-3-yl]ethanol |
|---|---|
| PubChem CID | 71570815 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | 2-[(7R)-5,7-dimethyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,4,8,9-tetrahydropyrano[2,3-g][1,3]benzoxazin-3-yl]ethanol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc3c(c(C)c2O1)CN(CCO)CO3 |
| InChI | InChI=1S/C31H47NO3/c1-23(2)10-7-11-24(3)12-8-13-25(4)14-9-16-31(6)17-15-27-20-29-28(26(5)30(27)35-31)21-32(18-19-33)22-34-29/h10,12,14,20,33H,7-9,11,13,15-19,21-22H2,1-6H3/b24-12+,25-14+/t31-/m1/s1 |
| InChIKey | AVGZTRISNQGIPO-VMPKNKKGSA-N |
| XLogP | 7.42 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|