C36H57NO4 — CID 71570961
(8R)-2-(3,3-diethoxypropyl)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine (PubChem CID 71570961) has the molecular formula C36H57NO4 and a molecular weight of 567.86 g/mol. Its IUPAC name is (8R)-2-(3,3-diethoxypropyl)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine.
| Compound Name | (8R)-2-(3,3-diethoxypropyl)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine |
|---|---|
| PubChem CID | 71570961 |
| Molecular Formula | C36H57NO4 |
| Molecular Weight | 567.86 g/mol |
| Exact Mass | 567.43 |
| IUPAC Name | (8R)-2-(3,3-diethoxypropyl)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine |
| SMILES | CCOC(CCN1COc2cc(C)c3c(c2C1)CC[C@@](C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)O3)OCC |
| InChI | InChI=1S/C36H57NO4/c1-9-38-34(39-10-2)20-23-37-25-32-31-19-22-36(8,41-35(31)30(7)24-33(32)40-26-37)21-13-18-29(6)17-12-16-28(5)15-11-14-27(3)4/h14,16,18,24,34H,9-13,15,17,19-23,25-26H2,1-8H3/b28-16+,29-18+/t36-/m1/s1 |
| InChIKey | USFRKQFQOCYAMG-CYKCQARQSA-N |
| XLogP | 9.22 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.86 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|