C36H56N2O2 — CID 71570962
(8R)-5,6,8-trimethyl-2-(piperidin-4-ylmethyl)-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine (PubChem CID 71570962) has the molecular formula C36H56N2O2 and a molecular weight of 548.86 g/mol. Its IUPAC name is (8R)-5,6,8-trimethyl-2-(piperidin-4-ylmethyl)-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine.
| Compound Name | (8R)-5,6,8-trimethyl-2-(piperidin-4-ylmethyl)-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine |
|---|---|
| PubChem CID | 71570962 |
| Molecular Formula | C36H56N2O2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | (8R)-5,6,8-trimethyl-2-(piperidin-4-ylmethyl)-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c3c(c(C)c(C)c2O1)OCN(CC1CCNCC1)C3 |
| InChI | InChI=1S/C36H56N2O2/c1-26(2)11-8-12-27(3)13-9-14-28(4)15-10-19-36(7)20-16-32-33-24-38(23-31-17-21-37-22-18-31)25-39-34(33)29(5)30(6)35(32)40-36/h11,13,15,31,37H,8-10,12,14,16-25H2,1-7H3/b27-13+,28-15+/t36-/m1/s1 |
| InChIKey | FOXHYCXGLCVFMK-JVOKKMTMSA-N |
| XLogP | 8.74 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|