C40H57NO4 — CID 71571254
(8R)-2-[2-(3,4-dimethoxyphenyl)ethyl]-5,6,8-trimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine (PubChem CID 71571254) has the molecular formula C40H57NO4 and a molecular weight of 615.90 g/mol. Its IUPAC name is (8R)-2-[2-(3,4-dimethoxyphenyl)ethyl]-5,6,8-trimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine.
| Compound Name | (8R)-2-[2-(3,4-dimethoxyphenyl)ethyl]-5,6,8-trimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine |
|---|---|
| PubChem CID | 71571254 |
| Molecular Formula | C40H57NO4 |
| Molecular Weight | 615.90 g/mol |
| Exact Mass | 615.43 |
| IUPAC Name | (8R)-2-[2-(3,4-dimethoxyphenyl)ethyl]-5,6,8-trimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazine |
| SMILES | COc1ccc(CCN2COc3c(C)c(C)c4c(c3C2)CC[C@@](C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)O4)cc1OC |
| InChI | InChI=1S/C40H57NO4/c1-28(2)13-10-14-29(3)15-11-16-30(4)17-12-22-40(7)23-20-34-35-26-41(27-44-38(35)31(5)32(6)39(34)45-40)24-21-33-18-19-36(42-8)37(25-33)43-9/h13,15,17-19,25H,10-12,14,16,20-24,26-27H2,1-9H3/b29-15+,30-17+/t40-/m1/s1 |
| InChIKey | PRXNNNVXRCQENY-FBIXEXFJSA-N |
| XLogP | 10.00 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.90 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|