C39H55NO4 — CID 71571256
(7R)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5,7-dimethyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,4,8,9-tetrahydropyrano[2,3-g][1,3]benzoxazine (PubChem CID 71571256) has the molecular formula C39H55NO4 and a molecular weight of 601.87 g/mol. Its IUPAC name is (7R)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5,7-dimethyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,4,8,9-tetrahydropyrano[2,3-g][1,3]benzoxazine.
| Compound Name | (7R)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5,7-dimethyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,4,8,9-tetrahydropyrano[2,3-g][1,3]benzoxazine |
|---|---|
| PubChem CID | 71571256 |
| Molecular Formula | C39H55NO4 |
| Molecular Weight | 601.87 g/mol |
| Exact Mass | 601.41 |
| IUPAC Name | (7R)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5,7-dimethyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,4,8,9-tetrahydropyrano[2,3-g][1,3]benzoxazine |
| SMILES | COc1ccc(CCN2COc3cc4c(c(C)c3C2)O[C@](C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CC4)cc1OC |
| InChI | InChI=1S/C39H55NO4/c1-28(2)12-9-13-29(3)14-10-15-30(4)16-11-21-39(6)22-19-33-25-36-34(31(5)38(33)44-39)26-40(27-43-36)23-20-32-17-18-35(41-7)37(24-32)42-8/h12,14,16-18,24-25H,9-11,13,15,19-23,26-27H2,1-8H3/b29-14+,30-16+/t39-/m1/s1 |
| InChIKey | NHISQXFZEQCLDC-ARAFEZKFSA-N |
| XLogP | 9.69 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.87 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|