About 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium
4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium (PubChem CID 71572525) has the molecular formula C8H13F3NO+
and a molecular weight of 196.19 g/mol. Its IUPAC name is 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium.
Molecular Properties
| Compound Name | 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium |
| PubChem CID | 71572525 |
| Molecular Formula | C8H13F3NO+ |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium |
| SMILES | C[N+]1(/C=C(\F)C(F)F)CCOCC1 |
| InChI | InChI=1S/C8H13F3NO/c1-12(2-4-13-5-3-12)6-7(9)8(10)11/h6,8H,2-5H2,1H3/q+1/b7-6- |
| InChIKey | YIYNDJXTSBQZSL-SREVYHEPSA-N |
| XLogP | 1.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium?
The IUPAC name of 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium (CID 71572525) is 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium.
What is the SMILES notation for 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium?
The canonical SMILES for 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium is C[N+]1(/C=C(\F)C(F)F)CCOCC1.
What is the InChIKey of 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium?
The InChIKey is YIYNDJXTSBQZSL-SREVYHEPSA-N. The full InChI is InChI=1S/C8H13F3NO/c1-12(2-4-13-5-3-12)6-7(9)8(10)11/h6,8H,2-5H2,1H3/q+1/b7-6-.
What are the key properties of 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium?
4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium has a molecular weight of 196.19 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-[(Z)-2,3,3-trifluoroprop-1-enyl]morpholin-4-ium is sourced from PubChem (CID 71572525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).