C5H10OS — CID 7157264
(2R,3S)-2-methyloxolane-3-thiol (PubChem CID 7157264) has the molecular formula C5H10OS and a molecular weight of 118.20 g/mol. Its IUPAC name is (2R,3S)-2-methyloxolane-3-thiol.
| Compound Name | (2R,3S)-2-methyloxolane-3-thiol |
|---|---|
| PubChem CID | 7157264 |
| Molecular Formula | C5H10OS |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | (2R,3S)-2-methyloxolane-3-thiol |
| SMILES | C[C@H]1OCC[C@@H]1S |
| InChI | InChI=1S/C5H10OS/c1-4-5(7)2-3-6-4/h4-5,7H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | DBPHPBLAKVZXOY-UHNVWZDZSA-N |
| XLogP | 1.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|