C28H48O3Si — CID 71572662
(11S,13S,14S,17S)-13-ethyl-3-methoxy-17-[(2-methylpropan-2-yl)oxy]-11-(trimethylsilylmethyl)-4,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-ol (PubChem CID 71572662) has the molecular formula C28H48O3Si and a molecular weight of 460.78 g/mol. Its IUPAC name is (11S,13S,14S,17S)-13-ethyl-3-methoxy-17-[(2-methylpropan-2-yl)oxy]-11-(trimethylsilylmethyl)-4,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-ol.
| Compound Name | (11S,13S,14S,17S)-13-ethyl-3-methoxy-17-[(2-methylpropan-2-yl)oxy]-11-(trimethylsilylmethyl)-4,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 71572662 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | (11S,13S,14S,17S)-13-ethyl-3-methoxy-17-[(2-methylpropan-2-yl)oxy]-11-(trimethylsilylmethyl)-4,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-ol |
| SMILES | CC[C@]12C[C@@](O)(C[Si](C)(C)C)C3C4=C(CCC3[C@@H]1CC[C@@H]2OC(C)(C)C)CC(OC)=CC4 |
| InChI | InChI=1S/C28H48O3Si/c1-9-27-17-28(29,18-32(6,7)8)25-21-13-11-20(30-5)16-19(21)10-12-22(25)23(27)14-15-24(27)31-26(2,3)4/h11,22-25,29H,9-10,12-18H2,1-8H3/t22?,23-,24-,25?,27-,28+/m0/s1 |
| InChIKey | MDYRCZZKGJUVMC-QKRUQEMSSA-N |
| XLogP | 7.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|